C22H21ClN6S — CID 45027433
(3E)-1-(4-chlorophenyl)-3-[2,3-dihydroindol-1-yl-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]thiourea (PubChem CID 45027433) has the molecular formula C22H21ClN6S and a molecular weight of 436.97 g/mol. Its IUPAC name is (3E)-1-(4-chlorophenyl)-3-[2,3-dihydroindol-1-yl-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]thiourea.
| Compound Name | (3E)-1-(4-chlorophenyl)-3-[2,3-dihydroindol-1-yl-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]thiourea |
|---|---|
| PubChem CID | 45027433 |
| Molecular Formula | C22H21ClN6S |
| Molecular Weight | 436.97 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | (3E)-1-(4-chlorophenyl)-3-[2,3-dihydroindol-1-yl-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]thiourea |
| SMILES | Cc1cc(C)nc(N/C(=N\C(=S)Nc2ccc(Cl)cc2)N2CCc3ccccc32)n1 |
| InChI | InChI=1S/C22H21ClN6S/c1-14-13-15(2)25-20(24-14)27-21(29-12-11-16-5-3-4-6-19(16)29)28-22(30)26-18-9-7-17(23)8-10-18/h3-10,13H,11-12H2,1-2H3,(H2,24,25,26,27,28,30) |
| InChIKey | FYKUDGQHHWQUCY-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.97 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|