C27H28F3N7O2S — CID 17090991
(1Z)-1-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-[4-(trifluoromethyl)phenyl]thiourea (PubChem CID 17090991) has the molecular formula C27H28F3N7O2S and a molecular weight of 571.63 g/mol. Its IUPAC name is (1Z)-1-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-[4-(trifluoromethyl)phenyl]thiourea.
| Compound Name | (1Z)-1-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-[4-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 17090991 |
| Molecular Formula | C27H28F3N7O2S |
| Molecular Weight | 571.63 g/mol |
| Exact Mass | 571.20 |
| IUPAC Name | (1Z)-1-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-[4-(trifluoromethyl)phenyl]thiourea |
| SMILES | Cc1cc(C)nc(N/C(=N/C(=S)Nc2ccc(C(F)(F)F)cc2)N2CCN(Cc3ccc4c(c3)OCO4)CC2)n1 |
| InChI | InChI=1S/C27H28F3N7O2S/c1-17-13-18(2)32-24(31-17)34-25(35-26(40)33-21-6-4-20(5-7-21)27(28,29)30)37-11-9-36(10-12-37)15-19-3-8-22-23(14-19)39-16-38-22/h3-8,13-14H,9-12,15-16H2,1-2H3,(H2,31,32,33,34,35,40) |
| InChIKey | LPGYZNXVYSWYSL-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.63 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|