C21H25N5O3 — CID 109320091
[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-[6-methyl-2-(prop-2-enylamino)pyrimidin-4-yl]methanone (PubChem CID 109320091) has the molecular formula C21H25N5O3 and a molecular weight of 395.46 g/mol. Its IUPAC name is [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-[6-methyl-2-(prop-2-enylamino)pyrimidin-4-yl]methanone.
| Compound Name | [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-[6-methyl-2-(prop-2-enylamino)pyrimidin-4-yl]methanone |
|---|---|
| PubChem CID | 109320091 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-[6-methyl-2-(prop-2-enylamino)pyrimidin-4-yl]methanone |
| SMILES | C=CCNc1nc(C)cc(C(=O)N2CCN(Cc3ccc4c(c3)OCO4)CC2)n1 |
| InChI | InChI=1S/C21H25N5O3/c1-3-6-22-21-23-15(2)11-17(24-21)20(27)26-9-7-25(8-10-26)13-16-4-5-18-19(12-16)29-14-28-18/h3-5,11-12H,1,6-10,13-14H2,2H3,(H,22,23,24) |
| InChIKey | CIINWDIFZFJIEN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|