C27H31N7O3 — CID 135610009
1-[(E)-C-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-(4,6-dimethylpyrimidin-2-yl)carbonimidoyl]-3-(4-methylphenyl)urea (PubChem CID 135610009) has the molecular formula C27H31N7O3 and a molecular weight of 501.59 g/mol. Its IUPAC name is 1-[(E)-C-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-(4,6-dimethylpyrimidin-2-yl)carbonimidoyl]-3-(4-methylphenyl)urea.
| Compound Name | 1-[(E)-C-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-(4,6-dimethylpyrimidin-2-yl)carbonimidoyl]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 135610009 |
| Molecular Formula | C27H31N7O3 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | 1-[(E)-C-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-(4,6-dimethylpyrimidin-2-yl)carbonimidoyl]-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)N/C(=N\c2nc(C)cc(C)n2)N2CCN(Cc3ccc4c(c3)OCO4)CC2)cc1 |
| InChI | InChI=1S/C27H31N7O3/c1-18-4-7-22(8-5-18)30-27(35)32-26(31-25-28-19(2)14-20(3)29-25)34-12-10-33(11-13-34)16-21-6-9-23-24(15-21)37-17-36-23/h4-9,14-15H,10-13,16-17H2,1-3H3,(H2,28,29,30,31,32,35) |
| InChIKey | AXEUSNMYVOGGIG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|