C22H25N3O4 — CID 44902729
2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-(2,5-dimethylphenyl)-2-oxoacetamide (PubChem CID 44902729) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-(2,5-dimethylphenyl)-2-oxoacetamide.
| Compound Name | 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-(2,5-dimethylphenyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 44902729 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-(2,5-dimethylphenyl)-2-oxoacetamide |
| SMILES | Cc1ccc(C)c(NC(=O)C(=O)N2CCN(Cc3ccc4c(c3)OCO4)CC2)c1 |
| InChI | InChI=1S/C22H25N3O4/c1-15-3-4-16(2)18(11-15)23-21(26)22(27)25-9-7-24(8-10-25)13-17-5-6-19-20(12-17)29-14-28-19/h3-6,11-12H,7-10,13-14H2,1-2H3,(H,23,26) |
| InChIKey | JQOYPLXNLWALHF-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|