C21H24N4O4 — CID 108532743
N-(2-amino-5-methylphenyl)-2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-oxoacetamide (PubChem CID 108532743) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is N-(2-amino-5-methylphenyl)-2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-oxoacetamide.
| Compound Name | N-(2-amino-5-methylphenyl)-2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 108532743 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | N-(2-amino-5-methylphenyl)-2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-oxoacetamide |
| SMILES | Cc1ccc(N)c(NC(=O)C(=O)N2CCN(Cc3ccc4c(c3)OCO4)CC2)c1 |
| InChI | InChI=1S/C21H24N4O4/c1-14-2-4-16(22)17(10-14)23-20(26)21(27)25-8-6-24(7-9-25)12-15-3-5-18-19(11-15)29-13-28-18/h2-5,10-11H,6-9,12-13,22H2,1H3,(H,23,26) |
| InChIKey | WHNACNGDIIBHNL-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|