C21H22N4O5 — CID 108529477
2-amino-N-[2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-oxoacetyl]benzamide (PubChem CID 108529477) has the molecular formula C21H22N4O5 and a molecular weight of 410.43 g/mol. Its IUPAC name is 2-amino-N-[2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-oxoacetyl]benzamide.
| Compound Name | 2-amino-N-[2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-oxoacetyl]benzamide |
|---|---|
| PubChem CID | 108529477 |
| Molecular Formula | C21H22N4O5 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 2-amino-N-[2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-oxoacetyl]benzamide |
| SMILES | Nc1ccccc1C(=O)NC(=O)C(=O)N1CCN(Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C21H22N4O5/c22-16-4-2-1-3-15(16)19(26)23-20(27)21(28)25-9-7-24(8-10-25)12-14-5-6-17-18(11-14)30-13-29-17/h1-6,11H,7-10,12-13,22H2,(H,23,26,27) |
| InChIKey | PHXDBSFSZZJEOD-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 114.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|