C19H27N3O5 — CID 108525881
2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-(5-hydroxypentyl)-2-oxoacetamide (PubChem CID 108525881) has the molecular formula C19H27N3O5 and a molecular weight of 377.44 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-(5-hydroxypentyl)-2-oxoacetamide.
| Compound Name | 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-(5-hydroxypentyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 108525881 |
| Molecular Formula | C19H27N3O5 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-(5-hydroxypentyl)-2-oxoacetamide |
| SMILES | O=C(NCCCCCO)C(=O)N1CCN(Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C19H27N3O5/c23-11-3-1-2-6-20-18(24)19(25)22-9-7-21(8-10-22)13-15-4-5-16-17(12-15)27-14-26-16/h4-5,12,23H,1-3,6-11,13-14H2,(H,20,24) |
| InChIKey | KJVKZWUPIPKKIT-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|