C20H31N7O3S — CID 21383535
ethyl 4-[(Z)-N-(4,6-dimethylpyrimidin-2-yl)-N'-(oxolan-2-ylmethylcarbamothioyl)carbamimidoyl]piperazine-1-carboxylate (PubChem CID 21383535) has the molecular formula C20H31N7O3S and a molecular weight of 449.58 g/mol. Its IUPAC name is ethyl 4-[(Z)-N-(4,6-dimethylpyrimidin-2-yl)-N'-(oxolan-2-ylmethylcarbamothioyl)carbamimidoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(Z)-N-(4,6-dimethylpyrimidin-2-yl)-N'-(oxolan-2-ylmethylcarbamothioyl)carbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 21383535 |
| Molecular Formula | C20H31N7O3S |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | ethyl 4-[(Z)-N-(4,6-dimethylpyrimidin-2-yl)-N'-(oxolan-2-ylmethylcarbamothioyl)carbamimidoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(/C(=N\C(=S)NCC2CCCO2)Nc2nc(C)cc(C)n2)CC1 |
| InChI | InChI=1S/C20H31N7O3S/c1-4-29-20(28)27-9-7-26(8-10-27)18(24-17-22-14(2)12-15(3)23-17)25-19(31)21-13-16-6-5-11-30-16/h12,16H,4-11,13H2,1-3H3,(H2,21,22,23,24,25,31) |
| InChIKey | ZGEFVWFPYINRNY-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|