C17H27N7O2S — CID 17091030
1-[(Z)-N-(4,6-dimethylpyrimidin-2-yl)-N'-(2-methoxyethylcarbamothioyl)carbamimidoyl]piperidine-4-carboxamide (PubChem CID 17091030) has the molecular formula C17H27N7O2S and a molecular weight of 393.52 g/mol. Its IUPAC name is 1-[(Z)-N-(4,6-dimethylpyrimidin-2-yl)-N'-(2-methoxyethylcarbamothioyl)carbamimidoyl]piperidine-4-carboxamide.
| Compound Name | 1-[(Z)-N-(4,6-dimethylpyrimidin-2-yl)-N'-(2-methoxyethylcarbamothioyl)carbamimidoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 17091030 |
| Molecular Formula | C17H27N7O2S |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 1-[(Z)-N-(4,6-dimethylpyrimidin-2-yl)-N'-(2-methoxyethylcarbamothioyl)carbamimidoyl]piperidine-4-carboxamide |
| SMILES | COCCNC(=S)/N=C(/Nc1nc(C)cc(C)n1)N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C17H27N7O2S/c1-11-10-12(2)21-15(20-11)22-16(23-17(27)19-6-9-26-3)24-7-4-13(5-8-24)14(18)25/h10,13H,4-9H2,1-3H3,(H2,18,25)(H2,19,20,21,22,23,27) |
| InChIKey | UCARNPFVGWIRID-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 117.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|