C17H31N5O4 — CID 111539222
ethyl 4-[N'-[2-(dimethylamino)-2-oxoethyl]-N-(oxolan-2-ylmethyl)carbamimidoyl]piperazine-1-carboxylate (PubChem CID 111539222) has the molecular formula C17H31N5O4 and a molecular weight of 369.47 g/mol. Its IUPAC name is ethyl 4-[N'-[2-(dimethylamino)-2-oxoethyl]-N-(oxolan-2-ylmethyl)carbamimidoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[N'-[2-(dimethylamino)-2-oxoethyl]-N-(oxolan-2-ylmethyl)carbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111539222 |
| Molecular Formula | C17H31N5O4 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | ethyl 4-[N'-[2-(dimethylamino)-2-oxoethyl]-N-(oxolan-2-ylmethyl)carbamimidoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(/C(=N/CC(=O)N(C)C)NCC2CCCO2)CC1 |
| InChI | InChI=1S/C17H31N5O4/c1-4-25-17(24)22-9-7-21(8-10-22)16(19-13-15(23)20(2)3)18-12-14-6-5-11-26-14/h14H,4-13H2,1-3H3,(H,18,19) |
| InChIKey | BCDPGIFPTHYLSA-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|