C19H37N5O2 — CID 110042172
2-[[[3-(diethylaminomethyl)pyrrolidin-1-yl]-(oxolan-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110042172) has the molecular formula C19H37N5O2 and a molecular weight of 367.54 g/mol. Its IUPAC name is 2-[[[3-(diethylaminomethyl)pyrrolidin-1-yl]-(oxolan-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[3-(diethylaminomethyl)pyrrolidin-1-yl]-(oxolan-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110042172 |
| Molecular Formula | C19H37N5O2 |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.29 |
| IUPAC Name | 2-[[[3-(diethylaminomethyl)pyrrolidin-1-yl]-(oxolan-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CCN(CC)CC1CCN(/C(=N/CC(=O)N(C)C)NCC2CCCO2)C1 |
| InChI | InChI=1S/C19H37N5O2/c1-5-23(6-2)14-16-9-10-24(15-16)19(21-13-18(25)22(3)4)20-12-17-8-7-11-26-17/h16-17H,5-15H2,1-4H3,(H,20,21) |
| InChIKey | NADNTHZMMWQLHM-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 60.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|