C16H30N4O2S — CID 110043767
2-[[(2-ethylthiomorpholin-4-yl)-(oxolan-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110043767) has the molecular formula C16H30N4O2S and a molecular weight of 342.51 g/mol. Its IUPAC name is 2-[[(2-ethylthiomorpholin-4-yl)-(oxolan-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(2-ethylthiomorpholin-4-yl)-(oxolan-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110043767 |
| Molecular Formula | C16H30N4O2S |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 2-[[(2-ethylthiomorpholin-4-yl)-(oxolan-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CCC1CN(/C(=N/CC(=O)N(C)C)NCC2CCCO2)CCS1 |
| InChI | InChI=1S/C16H30N4O2S/c1-4-14-12-20(7-9-23-14)16(18-11-15(21)19(2)3)17-10-13-6-5-8-22-13/h13-14H,4-12H2,1-3H3,(H,17,18) |
| InChIKey | OFISBIMYTRGRLJ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|