C22H35IN4O2 — CID 110044338
N,N-dimethyl-2-[[(3-methyl-4-phenylpiperidin-1-yl)-(oxolan-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 110044338) has the molecular formula C22H35IN4O2 and a molecular weight of 514.45 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(3-methyl-4-phenylpiperidin-1-yl)-(oxolan-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[(3-methyl-4-phenylpiperidin-1-yl)-(oxolan-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110044338 |
| Molecular Formula | C22H35IN4O2 |
| Molecular Weight | 514.45 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | N,N-dimethyl-2-[[(3-methyl-4-phenylpiperidin-1-yl)-(oxolan-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | CC1CN(/C(=N/CC(=O)N(C)C)NCC2CCCO2)CCC1c1ccccc1.I |
| InChI | InChI=1S/C22H34N4O2.HI/c1-17-16-26(12-11-20(17)18-8-5-4-6-9-18)22(24-15-21(27)25(2)3)23-14-19-10-7-13-28-19;/h4-6,8-9,17,19-20H,7,10-16H2,1-3H3,(H,23,24);1H |
| InChIKey | UZQDYFPLCONSTB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|