C22H32F3IN4O2 — CID 110050053
N,N-dimethyl-2-[[(oxan-2-ylmethylamino)-[3-[3-(trifluoromethyl)phenyl]pyrrolidin-1-yl]methylidene]amino]acetamide;hydroiodide (PubChem CID 110050053) has the molecular formula C22H32F3IN4O2 and a molecular weight of 568.42 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(oxan-2-ylmethylamino)-[3-[3-(trifluoromethyl)phenyl]pyrrolidin-1-yl]methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[(oxan-2-ylmethylamino)-[3-[3-(trifluoromethyl)phenyl]pyrrolidin-1-yl]methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110050053 |
| Molecular Formula | C22H32F3IN4O2 |
| Molecular Weight | 568.42 g/mol |
| Exact Mass | 568.15 |
| IUPAC Name | N,N-dimethyl-2-[[(oxan-2-ylmethylamino)-[3-[3-(trifluoromethyl)phenyl]pyrrolidin-1-yl]methylidene]amino]acetamide;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(\NCC1CCCCO1)N1CCC(c2cccc(C(F)(F)F)c2)C1.I |
| InChI | InChI=1S/C22H31F3N4O2.HI/c1-28(2)20(30)14-27-21(26-13-19-8-3-4-11-31-19)29-10-9-17(15-29)16-6-5-7-18(12-16)22(23,24)25;/h5-7,12,17,19H,3-4,8-11,13-15H2,1-2H3,(H,26,27);1H |
| InChIKey | YIWVHEWPAHQJIK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|