C19H27F3N4OS — CID 110050070
N,N-dimethyl-2-[[(2-methylsulfanylethylamino)-[3-[3-(trifluoromethyl)phenyl]pyrrolidin-1-yl]methylidene]amino]acetamide (PubChem CID 110050070) has the molecular formula C19H27F3N4OS and a molecular weight of 416.51 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(2-methylsulfanylethylamino)-[3-[3-(trifluoromethyl)phenyl]pyrrolidin-1-yl]methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[(2-methylsulfanylethylamino)-[3-[3-(trifluoromethyl)phenyl]pyrrolidin-1-yl]methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110050070 |
| Molecular Formula | C19H27F3N4OS |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | N,N-dimethyl-2-[[(2-methylsulfanylethylamino)-[3-[3-(trifluoromethyl)phenyl]pyrrolidin-1-yl]methylidene]amino]acetamide |
| SMILES | CSCCN/C(=N\CC(=O)N(C)C)N1CCC(c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C19H27F3N4OS/c1-25(2)17(27)12-24-18(23-8-10-28-3)26-9-7-15(13-26)14-5-4-6-16(11-14)19(20,21)22/h4-6,11,15H,7-10,12-13H2,1-3H3,(H,23,24) |
| InChIKey | JVUKKPBMVJQPHW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|