C15H28N4OS — CID 110046964
2-[[6-azaspiro[3.4]octan-6-yl-(2-methylsulfanylethylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110046964) has the molecular formula C15H28N4OS and a molecular weight of 312.48 g/mol. Its IUPAC name is 2-[[6-azaspiro[3.4]octan-6-yl-(2-methylsulfanylethylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[6-azaspiro[3.4]octan-6-yl-(2-methylsulfanylethylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110046964 |
| Molecular Formula | C15H28N4OS |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 2-[[6-azaspiro[3.4]octan-6-yl-(2-methylsulfanylethylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CSCCN/C(=N\CC(=O)N(C)C)N1CCC2(CCC2)C1 |
| InChI | InChI=1S/C15H28N4OS/c1-18(2)13(20)11-17-14(16-8-10-21-3)19-9-7-15(12-19)5-4-6-15/h4-12H2,1-3H3,(H,16,17) |
| InChIKey | DQYMLBFGGFAORR-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|