C17H33IN4O2S — CID 110044406
2-[[(2-methoxyethylamino)-(1-thia-4-azaspiro[5.5]undecan-4-yl)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110044406) has the molecular formula C17H33IN4O2S and a molecular weight of 484.45 g/mol. Its IUPAC name is 2-[[(2-methoxyethylamino)-(1-thia-4-azaspiro[5.5]undecan-4-yl)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[(2-methoxyethylamino)-(1-thia-4-azaspiro[5.5]undecan-4-yl)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110044406 |
| Molecular Formula | C17H33IN4O2S |
| Molecular Weight | 484.45 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 2-[[(2-methoxyethylamino)-(1-thia-4-azaspiro[5.5]undecan-4-yl)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | COCCN/C(=N\CC(=O)N(C)C)N1CCSC2(CCCCC2)C1.I |
| InChI | InChI=1S/C17H32N4O2S.HI/c1-20(2)15(22)13-19-16(18-9-11-23-3)21-10-12-24-17(14-21)7-5-4-6-8-17;/h4-14H2,1-3H3,(H,18,19);1H |
| InChIKey | OHLGKAGNVSFRSI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.45 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|