C18H35N5O4S — CID 110050022
2-[[[3-(cyclopentylsulfamoyl)piperidin-1-yl]-(2-methoxyethylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110050022) has the molecular formula C18H35N5O4S and a molecular weight of 417.58 g/mol. Its IUPAC name is 2-[[[3-(cyclopentylsulfamoyl)piperidin-1-yl]-(2-methoxyethylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[3-(cyclopentylsulfamoyl)piperidin-1-yl]-(2-methoxyethylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110050022 |
| Molecular Formula | C18H35N5O4S |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 2-[[[3-(cyclopentylsulfamoyl)piperidin-1-yl]-(2-methoxyethylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | COCCN/C(=N\CC(=O)N(C)C)N1CCCC(S(=O)(=O)NC2CCCC2)C1 |
| InChI | InChI=1S/C18H35N5O4S/c1-22(2)17(24)13-20-18(19-10-12-27-3)23-11-6-9-16(14-23)28(25,26)21-15-7-4-5-8-15/h15-16,21H,4-14H2,1-3H3,(H,19,20) |
| InChIKey | RNIZDCOBMJEMHN-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 103.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|