C20H37N5O3S — CID 110050010
2-[[(cyclopentylamino)-[3-(cyclopentylsulfamoyl)piperidin-1-yl]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110050010) has the molecular formula C20H37N5O3S and a molecular weight of 427.62 g/mol. Its IUPAC name is 2-[[(cyclopentylamino)-[3-(cyclopentylsulfamoyl)piperidin-1-yl]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(cyclopentylamino)-[3-(cyclopentylsulfamoyl)piperidin-1-yl]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110050010 |
| Molecular Formula | C20H37N5O3S |
| Molecular Weight | 427.62 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | 2-[[(cyclopentylamino)-[3-(cyclopentylsulfamoyl)piperidin-1-yl]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C/N=C(/NC1CCCC1)N1CCCC(S(=O)(=O)NC2CCCC2)C1 |
| InChI | InChI=1S/C20H37N5O3S/c1-24(2)19(26)14-21-20(22-16-8-3-4-9-16)25-13-7-12-18(15-25)29(27,28)23-17-10-5-6-11-17/h16-18,23H,3-15H2,1-2H3,(H,21,22) |
| InChIKey | CFWNAVDMIXUTKS-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.62 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|