C21H37N5O3 — CID 110043013
ethyl 4-[[C-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-N-[2-(dimethylamino)-2-oxoethyl]carbonimidoyl]amino]piperidine-1-carboxylate (PubChem CID 110043013) has the molecular formula C21H37N5O3 and a molecular weight of 407.56 g/mol. Its IUPAC name is ethyl 4-[[C-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-N-[2-(dimethylamino)-2-oxoethyl]carbonimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[C-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-N-[2-(dimethylamino)-2-oxoethyl]carbonimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 110043013 |
| Molecular Formula | C21H37N5O3 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.29 |
| IUPAC Name | ethyl 4-[[C-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-N-[2-(dimethylamino)-2-oxoethyl]carbonimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N/C(=N/CC(=O)N(C)C)N2CC3CCCCC3C2)CC1 |
| InChI | InChI=1S/C21H37N5O3/c1-4-29-21(28)25-11-9-18(10-12-25)23-20(22-13-19(27)24(2)3)26-14-16-7-5-6-8-17(16)15-26/h16-18H,4-15H2,1-3H3,(H,22,23) |
| InChIKey | JRPJJPPQCMORCH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|