C21H40N6O3 — CID 110038469
2-[[[4-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]piperazin-1-yl]-(2-methoxyethylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110038469) has the molecular formula C21H40N6O3 and a molecular weight of 424.59 g/mol. Its IUPAC name is 2-[[[4-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]piperazin-1-yl]-(2-methoxyethylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[4-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]piperazin-1-yl]-(2-methoxyethylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110038469 |
| Molecular Formula | C21H40N6O3 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.32 |
| IUPAC Name | 2-[[[4-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]piperazin-1-yl]-(2-methoxyethylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | COCCN/C(=N\CC(=O)N(C)C)N1CCN(CC(=O)N2CC(C)CC(C)C2)CC1 |
| InChI | InChI=1S/C21H40N6O3/c1-17-12-18(2)15-27(14-17)20(29)16-25-7-9-26(10-8-25)21(22-6-11-30-5)23-13-19(28)24(3)4/h17-18H,6-16H2,1-5H3,(H,22,23) |
| InChIKey | NSPFMSSPYJIPHR-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 80.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|