C17H28N6O2 — CID 111541262
2-[[(2-methoxyethylamino)-(4-pyridin-2-ylpiperazin-1-yl)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 111541262) has the molecular formula C17H28N6O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 2-[[(2-methoxyethylamino)-(4-pyridin-2-ylpiperazin-1-yl)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(2-methoxyethylamino)-(4-pyridin-2-ylpiperazin-1-yl)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111541262 |
| Molecular Formula | C17H28N6O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 2-[[(2-methoxyethylamino)-(4-pyridin-2-ylpiperazin-1-yl)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | COCCN/C(=N\CC(=O)N(C)C)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C17H28N6O2/c1-21(2)16(24)14-20-17(19-8-13-25-3)23-11-9-22(10-12-23)15-6-4-5-7-18-15/h4-7H,8-14H2,1-3H3,(H,19,20) |
| InChIKey | RQJNSIQBDOVMBA-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|