C16H28N6O5S — CID 110044433
2-[[(2-methoxyethylamino)-[4-(1,2-oxazol-3-ylmethylsulfonyl)piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110044433) has the molecular formula C16H28N6O5S and a molecular weight of 416.50 g/mol. Its IUPAC name is 2-[[(2-methoxyethylamino)-[4-(1,2-oxazol-3-ylmethylsulfonyl)piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(2-methoxyethylamino)-[4-(1,2-oxazol-3-ylmethylsulfonyl)piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110044433 |
| Molecular Formula | C16H28N6O5S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 2-[[(2-methoxyethylamino)-[4-(1,2-oxazol-3-ylmethylsulfonyl)piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | COCCN/C(=N\CC(=O)N(C)C)N1CCN(S(=O)(=O)Cc2ccon2)CC1 |
| InChI | InChI=1S/C16H28N6O5S/c1-20(2)15(23)12-18-16(17-5-11-26-3)21-6-8-22(9-7-21)28(24,25)13-14-4-10-27-19-14/h4,10H,5-9,11-13H2,1-3H3,(H,17,18) |
| InChIKey | FWAWDICHVHHASC-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 120.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|