C21H31IN6O2 — CID 110043942
N,N-dimethyl-2-[[[4-(1,2-oxazol-3-ylmethyl)piperazin-1-yl]-(2-phenylethylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 110043942) has the molecular formula C21H31IN6O2 and a molecular weight of 526.42 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[4-(1,2-oxazol-3-ylmethyl)piperazin-1-yl]-(2-phenylethylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[[4-(1,2-oxazol-3-ylmethyl)piperazin-1-yl]-(2-phenylethylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110043942 |
| Molecular Formula | C21H31IN6O2 |
| Molecular Weight | 526.42 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | N,N-dimethyl-2-[[[4-(1,2-oxazol-3-ylmethyl)piperazin-1-yl]-(2-phenylethylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(\NCCc1ccccc1)N1CCN(Cc2ccon2)CC1.I |
| InChI | InChI=1S/C21H30N6O2.HI/c1-25(2)20(28)16-23-21(22-10-8-18-6-4-3-5-7-18)27-13-11-26(12-14-27)17-19-9-15-29-24-19;/h3-7,9,15H,8,10-14,16-17H2,1-2H3,(H,22,23);1H |
| InChIKey | LKSDRQQNIGUIEP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 77.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.42 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|