C23H35N5O3 — CID 110038043
N,N-dimethyl-2-[[[4-(morpholine-4-carbonyl)piperidin-1-yl]-(2-phenylethylamino)methylidene]amino]acetamide (PubChem CID 110038043) has the molecular formula C23H35N5O3 and a molecular weight of 429.57 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[4-(morpholine-4-carbonyl)piperidin-1-yl]-(2-phenylethylamino)methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[[4-(morpholine-4-carbonyl)piperidin-1-yl]-(2-phenylethylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110038043 |
| Molecular Formula | C23H35N5O3 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | N,N-dimethyl-2-[[[4-(morpholine-4-carbonyl)piperidin-1-yl]-(2-phenylethylamino)methylidene]amino]acetamide |
| SMILES | CN(C)C(=O)C/N=C(\NCCc1ccccc1)N1CCC(C(=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C23H35N5O3/c1-26(2)21(29)18-25-23(24-11-8-19-6-4-3-5-7-19)28-12-9-20(10-13-28)22(30)27-14-16-31-17-15-27/h3-7,20H,8-18H2,1-2H3,(H,24,25) |
| InChIKey | MYLRARUARRTZQW-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|