C25H34N4O3 — CID 110053616
N'-[2-(furan-2-yl)ethyl]-4-(morpholine-4-carbonyl)-N-(2-phenylethyl)piperidine-1-carboximidamide (PubChem CID 110053616) has the molecular formula C25H34N4O3 and a molecular weight of 438.57 g/mol. Its IUPAC name is N'-[2-(furan-2-yl)ethyl]-4-(morpholine-4-carbonyl)-N-(2-phenylethyl)piperidine-1-carboximidamide.
| Compound Name | N'-[2-(furan-2-yl)ethyl]-4-(morpholine-4-carbonyl)-N-(2-phenylethyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 110053616 |
| Molecular Formula | C25H34N4O3 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | N'-[2-(furan-2-yl)ethyl]-4-(morpholine-4-carbonyl)-N-(2-phenylethyl)piperidine-1-carboximidamide |
| SMILES | O=C(C1CCN(/C(=N/CCc2ccco2)NCCc2ccccc2)CC1)N1CCOCC1 |
| InChI | InChI=1S/C25H34N4O3/c30-24(28-16-19-31-20-17-28)22-10-14-29(15-11-22)25(27-13-9-23-7-4-18-32-23)26-12-8-21-5-2-1-3-6-21/h1-7,18,22H,8-17,19-20H2,(H,26,27) |
| InChIKey | LOKXTPSMTAJYCM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|