C23H32IN3O4 — CID 111541551
methyl 1-[N'-[2-(furan-2-yl)ethyl]-N-[2-(4-methoxyphenyl)ethyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111541551) has the molecular formula C23H32IN3O4 and a molecular weight of 541.43 g/mol. Its IUPAC name is methyl 1-[N'-[2-(furan-2-yl)ethyl]-N-[2-(4-methoxyphenyl)ethyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | methyl 1-[N'-[2-(furan-2-yl)ethyl]-N-[2-(4-methoxyphenyl)ethyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111541551 |
| Molecular Formula | C23H32IN3O4 |
| Molecular Weight | 541.43 g/mol |
| Exact Mass | 541.14 |
| IUPAC Name | methyl 1-[N'-[2-(furan-2-yl)ethyl]-N-[2-(4-methoxyphenyl)ethyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | COC(=O)C1CCN(/C(=N/CCc2ccco2)NCCc2ccc(OC)cc2)CC1.I |
| InChI | InChI=1S/C23H31N3O4.HI/c1-28-20-7-5-18(6-8-20)9-13-24-23(25-14-10-21-4-3-17-30-21)26-15-11-19(12-16-26)22(27)29-2;/h3-8,17,19H,9-16H2,1-2H3,(H,24,25);1H |
| InChIKey | XTUBGYPLFLUBNT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|