C21H31IN4O2 — CID 110053443
N-[2-(furan-2-yl)ethyl]-4-(4-methoxyphenyl)-N'-propylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 110053443) has the molecular formula C21H31IN4O2 and a molecular weight of 498.41 g/mol. Its IUPAC name is N-[2-(furan-2-yl)ethyl]-4-(4-methoxyphenyl)-N'-propylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[2-(furan-2-yl)ethyl]-4-(4-methoxyphenyl)-N'-propylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110053443 |
| Molecular Formula | C21H31IN4O2 |
| Molecular Weight | 498.41 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | N-[2-(furan-2-yl)ethyl]-4-(4-methoxyphenyl)-N'-propylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCC/N=C(\NCCc1ccco1)N1CCN(c2ccc(OC)cc2)CC1.I |
| InChI | InChI=1S/C21H30N4O2.HI/c1-3-11-22-21(23-12-10-20-5-4-17-27-20)25-15-13-24(14-16-25)18-6-8-19(26-2)9-7-18;/h4-9,17H,3,10-16H2,1-2H3,(H,22,23);1H |
| InChIKey | RYHQEJJUVPNQQI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 53.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|