C19H27N3O2 — CID 111541292
1-[2-(furan-2-yl)ethyl]-3-[2-(4-methoxyphenyl)ethyl]-2-propylguanidine (PubChem CID 111541292) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-3-[2-(4-methoxyphenyl)ethyl]-2-propylguanidine.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-3-[2-(4-methoxyphenyl)ethyl]-2-propylguanidine |
|---|---|
| PubChem CID | 111541292 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-3-[2-(4-methoxyphenyl)ethyl]-2-propylguanidine |
| SMILES | CCC/N=C(/NCCc1ccc(OC)cc1)NCCc1ccco1 |
| InChI | InChI=1S/C19H27N3O2/c1-3-12-20-19(22-14-11-18-5-4-15-24-18)21-13-10-16-6-8-17(23-2)9-7-16/h4-9,15H,3,10-14H2,1-2H3,(H2,20,21,22) |
| InChIKey | OHXQXIVPQHMXGV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 58.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|