C21H29IN6O2 — CID 110051073
1-[2-(furan-2-yl)ethyl]-3-[2-(4-methoxyphenyl)ethyl]-2-[3-(triazol-1-yl)propyl]guanidine;hydroiodide (PubChem CID 110051073) has the molecular formula C21H29IN6O2 and a molecular weight of 524.41 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-3-[2-(4-methoxyphenyl)ethyl]-2-[3-(triazol-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-3-[2-(4-methoxyphenyl)ethyl]-2-[3-(triazol-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110051073 |
| Molecular Formula | C21H29IN6O2 |
| Molecular Weight | 524.41 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-3-[2-(4-methoxyphenyl)ethyl]-2-[3-(triazol-1-yl)propyl]guanidine;hydroiodide |
| SMILES | COc1ccc(CCN/C(=N/CCCn2ccnn2)NCCc2ccco2)cc1.I |
| InChI | InChI=1S/C21H28N6O2.HI/c1-28-19-7-5-18(6-8-19)9-12-23-21(24-13-10-20-4-2-17-29-20)22-11-3-15-27-16-14-25-26-27;/h2,4-8,14,16-17H,3,9-13,15H2,1H3,(H2,22,23,24);1H |
| InChIKey | HKPWPZVDSWSHQE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 89.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|