C19H32IN7O2 — CID 110051819
1-[2-(furan-2-yl)ethyl]-3-(3-morpholin-4-ylpropyl)-2-[3-(triazol-1-yl)propyl]guanidine;hydroiodide (PubChem CID 110051819) has the molecular formula C19H32IN7O2 and a molecular weight of 517.42 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-3-(3-morpholin-4-ylpropyl)-2-[3-(triazol-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-3-(3-morpholin-4-ylpropyl)-2-[3-(triazol-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110051819 |
| Molecular Formula | C19H32IN7O2 |
| Molecular Weight | 517.42 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-3-(3-morpholin-4-ylpropyl)-2-[3-(triazol-1-yl)propyl]guanidine;hydroiodide |
| SMILES | I.c1coc(CCN/C(=N\CCCn2ccnn2)NCCCN2CCOCC2)c1 |
| InChI | InChI=1S/C19H31N7O2.HI/c1-4-18(28-15-1)5-8-22-19(21-7-3-11-26-12-9-23-24-26)20-6-2-10-25-13-16-27-17-14-25;/h1,4,9,12,15H,2-3,5-8,10-11,13-14,16-17H2,(H2,20,21,22);1H |
| InChIKey | HZKCWXMFGZDUGQ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 92.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.42 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|