C21H29BrN4O2 — CID 111547815
2-[(4-bromophenyl)methyl]-1-[2-(furan-2-yl)ethyl]-3-(3-morpholin-4-ylpropyl)guanidine (PubChem CID 111547815) has the molecular formula C21H29BrN4O2 and a molecular weight of 449.39 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl]-1-[2-(furan-2-yl)ethyl]-3-(3-morpholin-4-ylpropyl)guanidine.
| Compound Name | 2-[(4-bromophenyl)methyl]-1-[2-(furan-2-yl)ethyl]-3-(3-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111547815 |
| Molecular Formula | C21H29BrN4O2 |
| Molecular Weight | 449.39 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 2-[(4-bromophenyl)methyl]-1-[2-(furan-2-yl)ethyl]-3-(3-morpholin-4-ylpropyl)guanidine |
| SMILES | Brc1ccc(C/N=C(\NCCCN2CCOCC2)NCCc2ccco2)cc1 |
| InChI | InChI=1S/C21H29BrN4O2/c22-19-6-4-18(5-7-19)17-25-21(24-10-8-20-3-1-14-28-20)23-9-2-11-26-12-15-27-16-13-26/h1,3-7,14H,2,8-13,15-17H2,(H2,23,24,25) |
| InChIKey | BMMLKRQTMFTNIE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 62.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|