C19H29IN4O3 — CID 110938477
1-[2-(furan-2-yl)ethyl]-2-(furan-2-ylmethyl)-3-(3-morpholin-4-ylpropyl)guanidine;hydroiodide (PubChem CID 110938477) has the molecular formula C19H29IN4O3 and a molecular weight of 488.37 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-2-(furan-2-ylmethyl)-3-(3-morpholin-4-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-2-(furan-2-ylmethyl)-3-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110938477 |
| Molecular Formula | C19H29IN4O3 |
| Molecular Weight | 488.37 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-2-(furan-2-ylmethyl)-3-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
| SMILES | I.c1coc(CCN/C(=N\Cc2ccco2)NCCCN2CCOCC2)c1 |
| InChI | InChI=1S/C19H28N4O3.HI/c1-4-17(25-12-1)6-8-21-19(22-16-18-5-2-13-26-18)20-7-3-9-23-10-14-24-15-11-23;/h1-2,4-5,12-13H,3,6-11,14-16H2,(H2,20,21,22);1H |
| InChIKey | POWKBPOJSPORAL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 75.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|