C14H25IN4O2 — CID 110938057
1-ethyl-2-(furan-2-ylmethyl)-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide (PubChem CID 110938057) has the molecular formula C14H25IN4O2 and a molecular weight of 408.28 g/mol. Its IUPAC name is 1-ethyl-2-(furan-2-ylmethyl)-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(furan-2-ylmethyl)-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110938057 |
| Molecular Formula | C14H25IN4O2 |
| Molecular Weight | 408.28 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 1-ethyl-2-(furan-2-ylmethyl)-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccco1)NCCN1CCOCC1.I |
| InChI | InChI=1S/C14H24N4O2.HI/c1-2-15-14(17-12-13-4-3-9-20-13)16-5-6-18-7-10-19-11-8-18;/h3-4,9H,2,5-8,10-12H2,1H3,(H2,15,16,17);1H |
| InChIKey | QOOZCPKJMZWQCE-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 62.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.28 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|