C22H30N4O4 — CID 111353328
2-(1,3-benzodioxol-5-ylmethyl)-1-[2-(furan-2-yl)ethyl]-3-(3-morpholin-4-ylpropyl)guanidine (PubChem CID 111353328) has the molecular formula C22H30N4O4 and a molecular weight of 414.51 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-1-[2-(furan-2-yl)ethyl]-3-(3-morpholin-4-ylpropyl)guanidine.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-[2-(furan-2-yl)ethyl]-3-(3-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111353328 |
| Molecular Formula | C22H30N4O4 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-[2-(furan-2-yl)ethyl]-3-(3-morpholin-4-ylpropyl)guanidine |
| SMILES | c1coc(CCN/C(=N/Cc2ccc3c(c2)OCO3)NCCCN2CCOCC2)c1 |
| InChI | InChI=1S/C22H30N4O4/c1-3-19(28-12-1)6-8-24-22(23-7-2-9-26-10-13-27-14-11-26)25-16-18-4-5-20-21(15-18)30-17-29-20/h1,3-5,12,15H,2,6-11,13-14,16-17H2,(H2,23,24,25) |
| InChIKey | GMDPKTFZMXAZPN-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|