C21H28IN3O4 — CID 110051129
2-(1,3-benzodioxol-5-ylmethyl)-1-[2-(furan-2-yl)ethyl]-3-(oxan-2-ylmethyl)guanidine;hydroiodide (PubChem CID 110051129) has the molecular formula C21H28IN3O4 and a molecular weight of 513.38 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-1-[2-(furan-2-yl)ethyl]-3-(oxan-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-[2-(furan-2-yl)ethyl]-3-(oxan-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110051129 |
| Molecular Formula | C21H28IN3O4 |
| Molecular Weight | 513.38 g/mol |
| Exact Mass | 513.11 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-[2-(furan-2-yl)ethyl]-3-(oxan-2-ylmethyl)guanidine;hydroiodide |
| SMILES | I.c1coc(CCN/C(=N\Cc2ccc3c(c2)OCO3)NCC2CCCCO2)c1 |
| InChI | InChI=1S/C21H27N3O4.HI/c1-2-10-26-18(4-1)14-24-21(22-9-8-17-5-3-11-25-17)23-13-16-6-7-19-20(12-16)28-15-27-19;/h3,5-7,11-12,18H,1-2,4,8-10,13-15H2,(H2,22,23,24);1H |
| InChIKey | WGWQEPLCNUVBPV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|