C19H26IN7O3S — CID 110051071
1-[2-(furan-2-yl)ethyl]-2-[(4-sulfamoylphenyl)methyl]-3-[3-(triazol-1-yl)propyl]guanidine;hydroiodide (PubChem CID 110051071) has the molecular formula C19H26IN7O3S and a molecular weight of 559.43 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-2-[(4-sulfamoylphenyl)methyl]-3-[3-(triazol-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-2-[(4-sulfamoylphenyl)methyl]-3-[3-(triazol-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110051071 |
| Molecular Formula | C19H26IN7O3S |
| Molecular Weight | 559.43 g/mol |
| Exact Mass | 559.09 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-2-[(4-sulfamoylphenyl)methyl]-3-[3-(triazol-1-yl)propyl]guanidine;hydroiodide |
| SMILES | I.NS(=O)(=O)c1ccc(C/N=C(\NCCCn2ccnn2)NCCc2ccco2)cc1 |
| InChI | InChI=1S/C19H25N7O3S.HI/c20-30(27,28)18-6-4-16(5-7-18)15-23-19(22-10-8-17-3-1-14-29-17)21-9-2-12-26-13-11-24-25-26;/h1,3-7,11,13-14H,2,8-10,12,15H2,(H2,20,27,28)(H2,21,22,23);1H |
| InChIKey | XDVBRMKDIGNLKV-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 140.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.43 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|