C22H36IN5O3S — CID 111248842
1-[2-[di(propan-2-yl)amino]ethyl]-3-[2-(furan-2-yl)ethyl]-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111248842) has the molecular formula C22H36IN5O3S and a molecular weight of 577.53 g/mol. Its IUPAC name is 1-[2-[di(propan-2-yl)amino]ethyl]-3-[2-(furan-2-yl)ethyl]-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-[di(propan-2-yl)amino]ethyl]-3-[2-(furan-2-yl)ethyl]-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111248842 |
| Molecular Formula | C22H36IN5O3S |
| Molecular Weight | 577.53 g/mol |
| Exact Mass | 577.16 |
| IUPAC Name | 1-[2-[di(propan-2-yl)amino]ethyl]-3-[2-(furan-2-yl)ethyl]-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CC(C)N(CCN/C(=N/Cc1ccc(S(N)(=O)=O)cc1)NCCc1ccco1)C(C)C.I |
| InChI | InChI=1S/C22H35N5O3S.HI/c1-17(2)27(18(3)4)14-13-25-22(24-12-11-20-6-5-15-30-20)26-16-19-7-9-21(10-8-19)31(23,28)29;/h5-10,15,17-18H,11-14,16H2,1-4H3,(H2,23,28,29)(H2,24,25,26);1H |
| InChIKey | YBFHWCIETVRFCT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 112.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.53 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|