C16H28IN3OS — CID 110057565
2-ethyl-N-[2-(furan-2-yl)ethyl]-N'-propylthiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 110057565) has the molecular formula C16H28IN3OS and a molecular weight of 437.39 g/mol. Its IUPAC name is 2-ethyl-N-[2-(furan-2-yl)ethyl]-N'-propylthiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | 2-ethyl-N-[2-(furan-2-yl)ethyl]-N'-propylthiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110057565 |
| Molecular Formula | C16H28IN3OS |
| Molecular Weight | 437.39 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 2-ethyl-N-[2-(furan-2-yl)ethyl]-N'-propylthiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CCC/N=C(\NCCc1ccco1)N1CCSC(CC)C1.I |
| InChI | InChI=1S/C16H27N3OS.HI/c1-3-8-17-16(18-9-7-14-6-5-11-20-14)19-10-12-21-15(4-2)13-19;/h5-6,11,15H,3-4,7-10,12-13H2,1-2H3,(H,17,18);1H |
| InChIKey | BWQQHXXPKRRLCS-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 40.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|