C23H28N6O — CID 111541116
N'-[2-(furan-2-yl)ethyl]-N-(2-phenylethyl)-4-pyrimidin-2-ylpiperazine-1-carboximidamide (PubChem CID 111541116) has the molecular formula C23H28N6O and a molecular weight of 404.52 g/mol. Its IUPAC name is N'-[2-(furan-2-yl)ethyl]-N-(2-phenylethyl)-4-pyrimidin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N'-[2-(furan-2-yl)ethyl]-N-(2-phenylethyl)-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111541116 |
| Molecular Formula | C23H28N6O |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | N'-[2-(furan-2-yl)ethyl]-N-(2-phenylethyl)-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
| SMILES | c1ccc(CCN/C(=N\CCc2ccco2)N2CCN(c3ncccn3)CC2)cc1 |
| InChI | InChI=1S/C23H28N6O/c1-2-6-20(7-3-1)9-13-26-23(27-14-10-21-8-4-19-30-21)29-17-15-28(16-18-29)22-24-11-5-12-25-22/h1-8,11-12,19H,9-10,13-18H2,(H,26,27) |
| InChIKey | RJGHCBQZMXWOFV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|