C20H31IN4O3 — CID 111541543
methyl 1-[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-phenylethyl)carbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111541543) has the molecular formula C20H31IN4O3 and a molecular weight of 502.40 g/mol. Its IUPAC name is methyl 1-[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-phenylethyl)carbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | methyl 1-[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-phenylethyl)carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111541543 |
| Molecular Formula | C20H31IN4O3 |
| Molecular Weight | 502.40 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | methyl 1-[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-phenylethyl)carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | COC(=O)C1CCN(/C(=N/CC(=O)N(C)C)NCCc2ccccc2)CC1.I |
| InChI | InChI=1S/C20H30N4O3.HI/c1-23(2)18(25)15-22-20(21-12-9-16-7-5-4-6-8-16)24-13-10-17(11-14-24)19(26)27-3;/h4-8,17H,9-15H2,1-3H3,(H,21,22);1H |
| InChIKey | XUCTYVNRRNDOEG-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|