C25H35IN4O2 — CID 110039840
2-[[(3-benzylpyrrolidin-1-yl)-[2-(4-methoxyphenyl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110039840) has the molecular formula C25H35IN4O2 and a molecular weight of 550.49 g/mol. Its IUPAC name is 2-[[(3-benzylpyrrolidin-1-yl)-[2-(4-methoxyphenyl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[(3-benzylpyrrolidin-1-yl)-[2-(4-methoxyphenyl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110039840 |
| Molecular Formula | C25H35IN4O2 |
| Molecular Weight | 550.49 g/mol |
| Exact Mass | 550.18 |
| IUPAC Name | 2-[[(3-benzylpyrrolidin-1-yl)-[2-(4-methoxyphenyl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | COc1ccc(CCN/C(=N/CC(=O)N(C)C)N2CCC(Cc3ccccc3)C2)cc1.I |
| InChI | InChI=1S/C25H34N4O2.HI/c1-28(2)24(30)18-27-25(26-15-13-20-9-11-23(31-3)12-10-20)29-16-14-22(19-29)17-21-7-5-4-6-8-21;/h4-12,22H,13-19H2,1-3H3,(H,26,27);1H |
| InChIKey | QGIBZFZJXSQCNY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.49 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|