C25H40IN5O2 — CID 110048664
2-[[(1-cyclopropyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-[2-(4-methoxyphenyl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110048664) has the molecular formula C25H40IN5O2 and a molecular weight of 569.53 g/mol. Its IUPAC name is 2-[[(1-cyclopropyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-[2-(4-methoxyphenyl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[(1-cyclopropyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-[2-(4-methoxyphenyl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110048664 |
| Molecular Formula | C25H40IN5O2 |
| Molecular Weight | 569.53 g/mol |
| Exact Mass | 569.22 |
| IUPAC Name | 2-[[(1-cyclopropyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-[2-(4-methoxyphenyl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | COc1ccc(CCN/C(=N\CC(=O)N(C)C)N2CCC3C(CCCN3C3CC3)C2)cc1.I |
| InChI | InChI=1S/C25H39N5O2.HI/c1-28(2)24(31)17-27-25(26-14-12-19-6-10-22(32-3)11-7-19)29-16-13-23-20(18-29)5-4-15-30(23)21-8-9-21;/h6-7,10-11,20-21,23H,4-5,8-9,12-18H2,1-3H3,(H,26,27);1H |
| InChIKey | RROWOATYLWHFNM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 60.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.53 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|