C22H34N4O4 — CID 110046211
2-[[[2-(4-methoxyphenyl)ethylamino]-[2-(oxolan-2-yl)morpholin-4-yl]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110046211) has the molecular formula C22H34N4O4 and a molecular weight of 418.54 g/mol. Its IUPAC name is 2-[[[2-(4-methoxyphenyl)ethylamino]-[2-(oxolan-2-yl)morpholin-4-yl]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[2-(4-methoxyphenyl)ethylamino]-[2-(oxolan-2-yl)morpholin-4-yl]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110046211 |
| Molecular Formula | C22H34N4O4 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | 2-[[[2-(4-methoxyphenyl)ethylamino]-[2-(oxolan-2-yl)morpholin-4-yl]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | COc1ccc(CCN/C(=N\CC(=O)N(C)C)N2CCOC(C3CCCO3)C2)cc1 |
| InChI | InChI=1S/C22H34N4O4/c1-25(2)21(27)15-24-22(23-11-10-17-6-8-18(28-3)9-7-17)26-12-14-30-20(16-26)19-5-4-13-29-19/h6-9,19-20H,4-5,10-16H2,1-3H3,(H,23,24) |
| InChIKey | JLQUZEURPIMFKA-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|