C22H33IN6O2 — CID 110041751
2-[[[2-(4-methoxyphenyl)ethylamino]-[3-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110041751) has the molecular formula C22H33IN6O2 and a molecular weight of 540.45 g/mol. Its IUPAC name is 2-[[[2-(4-methoxyphenyl)ethylamino]-[3-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[2-(4-methoxyphenyl)ethylamino]-[3-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110041751 |
| Molecular Formula | C22H33IN6O2 |
| Molecular Weight | 540.45 g/mol |
| Exact Mass | 540.17 |
| IUPAC Name | 2-[[[2-(4-methoxyphenyl)ethylamino]-[3-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | COc1ccc(CCN/C(=N/CC(=O)N(C)C)N2CCC(c3cnn(C)c3)C2)cc1.I |
| InChI | InChI=1S/C22H32N6O2.HI/c1-26(2)21(29)14-24-22(23-11-9-17-5-7-20(30-4)8-6-17)28-12-10-18(16-28)19-13-25-27(3)15-19;/h5-8,13,15,18H,9-12,14,16H2,1-4H3,(H,23,24);1H |
| InChIKey | PJLQDGZHCVDDKN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 74.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.45 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|