C21H34IN5OS — CID 110048674
2-[[(1-cyclopropyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-(thiophen-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110048674) has the molecular formula C21H34IN5OS and a molecular weight of 531.51 g/mol. Its IUPAC name is 2-[[(1-cyclopropyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-(thiophen-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[(1-cyclopropyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-(thiophen-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110048674 |
| Molecular Formula | C21H34IN5OS |
| Molecular Weight | 531.51 g/mol |
| Exact Mass | 531.15 |
| IUPAC Name | 2-[[(1-cyclopropyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-(thiophen-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(\NCc1cccs1)N1CCC2C(CCCN2C2CC2)C1.I |
| InChI | InChI=1S/C21H33N5OS.HI/c1-24(2)20(27)14-23-21(22-13-18-6-4-12-28-18)25-11-9-19-16(15-25)5-3-10-26(19)17-7-8-17;/h4,6,12,16-17,19H,3,5,7-11,13-15H2,1-2H3,(H,22,23);1H |
| InChIKey | KGQUTPSXUMZIAR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.51 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|