C20H25ClN4O2S — CID 110048851
2-[[[3-(2-chlorophenoxy)pyrrolidin-1-yl]-(thiophen-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110048851) has the molecular formula C20H25ClN4O2S and a molecular weight of 420.97 g/mol. Its IUPAC name is 2-[[[3-(2-chlorophenoxy)pyrrolidin-1-yl]-(thiophen-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[3-(2-chlorophenoxy)pyrrolidin-1-yl]-(thiophen-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110048851 |
| Molecular Formula | C20H25ClN4O2S |
| Molecular Weight | 420.97 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 2-[[[3-(2-chlorophenoxy)pyrrolidin-1-yl]-(thiophen-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C/N=C(\NCc1cccs1)N1CCC(Oc2ccccc2Cl)C1 |
| InChI | InChI=1S/C20H25ClN4O2S/c1-24(2)19(26)13-23-20(22-12-16-6-5-11-28-16)25-10-9-15(14-25)27-18-8-4-3-7-17(18)21/h3-8,11,15H,9-10,12-14H2,1-2H3,(H,22,23) |
| InChIKey | LJYJADCXGGXRPS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.97 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|