C21H34N4O3S — CID 110043051
N,N-dimethyl-2-[[[4-(oxan-2-ylmethoxy)piperidin-1-yl]-(thiophen-2-ylmethylamino)methylidene]amino]acetamide (PubChem CID 110043051) has the molecular formula C21H34N4O3S and a molecular weight of 422.60 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[4-(oxan-2-ylmethoxy)piperidin-1-yl]-(thiophen-2-ylmethylamino)methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[[4-(oxan-2-ylmethoxy)piperidin-1-yl]-(thiophen-2-ylmethylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110043051 |
| Molecular Formula | C21H34N4O3S |
| Molecular Weight | 422.60 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | N,N-dimethyl-2-[[[4-(oxan-2-ylmethoxy)piperidin-1-yl]-(thiophen-2-ylmethylamino)methylidene]amino]acetamide |
| SMILES | CN(C)C(=O)C/N=C(\NCc1cccs1)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C21H34N4O3S/c1-24(2)20(26)15-23-21(22-14-19-7-5-13-29-19)25-10-8-17(9-11-25)28-16-18-6-3-4-12-27-18/h5,7,13,17-18H,3-4,6,8-12,14-16H2,1-2H3,(H,22,23) |
| InChIKey | ZSSLUZIQBQVWCE-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.60 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|