C22H37N3O2S — CID 109448507
N-ethyl-N'-(2-methyl-2-thiophen-2-ylpropyl)-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide (PubChem CID 109448507) has the molecular formula C22H37N3O2S and a molecular weight of 407.62 g/mol. Its IUPAC name is N-ethyl-N'-(2-methyl-2-thiophen-2-ylpropyl)-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-(2-methyl-2-thiophen-2-ylpropyl)-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109448507 |
| Molecular Formula | C22H37N3O2S |
| Molecular Weight | 407.62 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | N-ethyl-N'-(2-methyl-2-thiophen-2-ylpropyl)-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(C)(C)c1cccs1)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C22H37N3O2S/c1-4-23-21(24-17-22(2,3)20-9-7-15-28-20)25-12-10-18(11-13-25)27-16-19-8-5-6-14-26-19/h7,9,15,18-19H,4-6,8,10-14,16-17H2,1-3H3,(H,23,24) |
| InChIKey | UDYXWHPPPOUDJN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.62 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|